C26H21N3O3S2 — CID 23803944
2-(1,3-benzothiazol-2-ylsulfanyl)-N-benzyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide (PubChem CID 23803944) has the molecular formula C26H21N3O3S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-benzyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-benzyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 23803944 |
| Molecular Formula | C26H21N3O3S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-benzyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide |
| SMILES | O=C1CC(N(Cc2ccccc2)C(=O)CSc2nc3ccccc3s2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C26H21N3O3S2/c30-23-15-21(25(32)29(23)19-11-5-2-6-12-19)28(16-18-9-3-1-4-10-18)24(31)17-33-26-27-20-13-7-8-14-22(20)34-26/h1-14,21H,15-17H2 |
| InChIKey | JTTIPTWLRLTYLJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|