C17H16N2OS2 — CID 2707132
2-(1,3-benzothiazol-2-ylsulfanyl)-N-benzyl-N-methylacetamide (PubChem CID 2707132) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-benzyl-N-methylacetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-benzyl-N-methylacetamide |
|---|---|
| PubChem CID | 2707132 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-benzyl-N-methylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H16N2OS2/c1-19(11-13-7-3-2-4-8-13)16(20)12-21-17-18-14-9-5-6-10-15(14)22-17/h2-10H,11-12H2,1H3 |
| InChIKey | SDTICHJHDJWDOC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |