C22H17FN4O4S3 — CID 2097266
4-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]carbamoyl]-N-(4-fluorophenyl)benzenesulfonamide (PubChem CID 2097266) has the molecular formula C22H17FN4O4S3 and a molecular weight of 516.60 g/mol. Its IUPAC name is 4-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]carbamoyl]-N-(4-fluorophenyl)benzenesulfonamide.
| Compound Name | 4-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]carbamoyl]-N-(4-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2097266 |
| Molecular Formula | C22H17FN4O4S3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 4-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]carbamoyl]-N-(4-fluorophenyl)benzenesulfonamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NNC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H17FN4O4S3/c23-15-7-9-16(10-8-15)27-34(30,31)17-11-5-14(6-12-17)21(29)26-25-20(28)13-32-22-24-18-3-1-2-4-19(18)33-22/h1-12,27H,13H2,(H,25,28)(H,26,29) |
| InChIKey | BVXKAKBOHPKOHJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|