C21H18FN3O4S — CID 46521478
N-[4-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide (PubChem CID 46521478) has the molecular formula C21H18FN3O4S and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[4-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46521478 |
| Molecular Formula | C21H18FN3O4S |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[4-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18FN3O4S/c22-17-10-6-15(7-11-17)14-20(26)23-24-21(27)16-8-12-18(13-9-16)25-30(28,29)19-4-2-1-3-5-19/h1-13,25H,14H2,(H,23,26)(H,24,27) |
| InChIKey | WSYVZRRQWXDPTC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|