C23H22FN3O5S — CID 26656829
4-ethoxy-N-[3-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide (PubChem CID 26656829) has the molecular formula C23H22FN3O5S and a molecular weight of 471.51 g/mol. Its IUPAC name is 4-ethoxy-N-[3-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[3-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26656829 |
| Molecular Formula | C23H22FN3O5S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 4-ethoxy-N-[3-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(C(=O)NNC(=O)Cc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C23H22FN3O5S/c1-2-32-20-10-12-21(13-11-20)33(30,31)27-19-5-3-4-17(15-19)23(29)26-25-22(28)14-16-6-8-18(24)9-7-16/h3-13,15,27H,2,14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | IZTLKFQAHHCHEP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|