C23H18FN3O2S2 — CID 24635702
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-[2-(2-fluorophenyl)acetyl]benzohydrazide (PubChem CID 24635702) has the molecular formula C23H18FN3O2S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-[2-(2-fluorophenyl)acetyl]benzohydrazide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-[2-(2-fluorophenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24635702 |
| Molecular Formula | C23H18FN3O2S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-[2-(2-fluorophenyl)acetyl]benzohydrazide |
| SMILES | O=C(Cc1ccccc1F)NNC(=O)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H18FN3O2S2/c24-18-6-2-1-5-17(18)13-21(28)26-27-22(29)16-11-9-15(10-12-16)14-30-23-25-19-7-3-4-8-20(19)31-23/h1-12H,13-14H2,(H,26,28)(H,27,29) |
| InChIKey | MCGNLNZJJWJXRQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|