C21H19N3O2S2 — CID 2408561
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(3-oxocyclohexen-1-yl)benzohydrazide (PubChem CID 2408561) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(3-oxocyclohexen-1-yl)benzohydrazide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(3-oxocyclohexen-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 2408561 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(3-oxocyclohexen-1-yl)benzohydrazide |
| SMILES | O=C1C=C(NNC(=O)c2ccc(CSc3nc4ccccc4s3)cc2)CCC1 |
| InChI | InChI=1S/C21H19N3O2S2/c25-17-5-3-4-16(12-17)23-24-20(26)15-10-8-14(9-11-15)13-27-21-22-18-6-1-2-7-19(18)28-21/h1-2,6-12,23H,3-5,13H2,(H,24,26) |
| InChIKey | AOFKHFUKJRJWJQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|