C22H23N7O2S2 — CID 4789478
N'-(4-amino-6-tert-butyl-5-oxo-1,2,4-triazin-3-yl)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzohydrazide (PubChem CID 4789478) has the molecular formula C22H23N7O2S2 and a molecular weight of 481.61 g/mol. Its IUPAC name is N'-(4-amino-6-tert-butyl-5-oxo-1,2,4-triazin-3-yl)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzohydrazide.
| Compound Name | N'-(4-amino-6-tert-butyl-5-oxo-1,2,4-triazin-3-yl)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 4789478 |
| Molecular Formula | C22H23N7O2S2 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N'-(4-amino-6-tert-butyl-5-oxo-1,2,4-triazin-3-yl)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzohydrazide |
| SMILES | CC(C)(C)c1nnc(NNC(=O)c2ccc(CSc3nc4ccccc4s3)cc2)n(N)c1=O |
| InChI | InChI=1S/C22H23N7O2S2/c1-22(2,3)17-19(31)29(23)20(27-25-17)28-26-18(30)14-10-8-13(9-11-14)12-32-21-24-15-6-4-5-7-16(15)33-21/h4-11H,12,23H2,1-3H3,(H,26,30)(H,27,28) |
| InChIKey | XMRQCQOHEFJNAI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|