C20H21N3O2S2 — CID 9399058
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(3-methylbutanoyl)benzohydrazide (PubChem CID 9399058) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(3-methylbutanoyl)benzohydrazide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(3-methylbutanoyl)benzohydrazide |
|---|---|
| PubChem CID | 9399058 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(3-methylbutanoyl)benzohydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H21N3O2S2/c1-13(2)11-18(24)22-23-19(25)15-9-7-14(8-10-15)12-26-20-21-16-5-3-4-6-17(16)27-20/h3-10,13H,11-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | DPWFYWKFFCDMHV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|