C25H21N3O4S2 — CID 24635745
N'-[3-(1,3-benzodioxol-5-yl)propanoyl]-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzohydrazide (PubChem CID 24635745) has the molecular formula C25H21N3O4S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is N'-[3-(1,3-benzodioxol-5-yl)propanoyl]-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzohydrazide.
| Compound Name | N'-[3-(1,3-benzodioxol-5-yl)propanoyl]-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 24635745 |
| Molecular Formula | C25H21N3O4S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | N'-[3-(1,3-benzodioxol-5-yl)propanoyl]-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzohydrazide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)NNC(=O)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C25H21N3O4S2/c29-23(12-8-16-7-11-20-21(13-16)32-15-31-20)27-28-24(30)18-9-5-17(6-10-18)14-33-25-26-19-3-1-2-4-22(19)34-25/h1-7,9-11,13H,8,12,14-15H2,(H,27,29)(H,28,30) |
| InChIKey | VCAKYXSZGSNRAY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|