C16H15N3O4 — CID 25295416
N'-[3-(1,3-benzodioxol-5-yl)propanoyl]pyridine-4-carbohydrazide (PubChem CID 25295416) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is N'-[3-(1,3-benzodioxol-5-yl)propanoyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[3-(1,3-benzodioxol-5-yl)propanoyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 25295416 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N'-[3-(1,3-benzodioxol-5-yl)propanoyl]pyridine-4-carbohydrazide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C16H15N3O4/c20-15(18-19-16(21)12-5-7-17-8-6-12)4-2-11-1-3-13-14(9-11)23-10-22-13/h1,3,5-9H,2,4,10H2,(H,18,20)(H,19,21) |
| InChIKey | JVAMWFLEGROFBT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|