C18H21N3O3 — CID 131952515
3-(1,3-benzodioxol-5-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide (PubChem CID 131952515) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 131952515 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide |
| SMILES | Cc1cnccc1NCCNC(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21N3O3/c1-13-11-19-7-6-15(13)20-8-9-21-18(22)5-3-14-2-4-16-17(10-14)24-12-23-16/h2,4,6-7,10-11H,3,5,8-9,12H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | VNEPPZBDXBLXSL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|