C17H18N2O3 — CID 18117902
N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-pyridin-3-ylpropanamide (PubChem CID 18117902) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 18117902 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-pyridin-3-ylpropanamide |
| SMILES | O=C(CCc1cccnc1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H18N2O3/c20-17(6-4-14-2-1-8-18-11-14)19-9-7-13-3-5-15-16(10-13)22-12-21-15/h1-3,5,8,10-11H,4,6-7,9,12H2,(H,19,20) |
| InChIKey | XJSBYCMNFOVMEX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |