C16H19N3O3 — CID 72848010
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(1H-pyrazol-4-yl)butanamide (PubChem CID 72848010) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(1H-pyrazol-4-yl)butanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(1H-pyrazol-4-yl)butanamide |
|---|---|
| PubChem CID | 72848010 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(1H-pyrazol-4-yl)butanamide |
| SMILES | O=C(CCCc1cn[nH]c1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H19N3O3/c20-16(3-1-2-13-9-18-19-10-13)17-7-6-12-4-5-14-15(8-12)22-11-21-14/h4-5,8-10H,1-3,6-7,11H2,(H,17,20)(H,18,19) |
| InChIKey | TXEURPQFZLAPCD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |