C16H23N3O3 — CID 134127537
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-pyrazolidin-4-ylbutanamide (PubChem CID 134127537) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-pyrazolidin-4-ylbutanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-pyrazolidin-4-ylbutanamide |
|---|---|
| PubChem CID | 134127537 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-pyrazolidin-4-ylbutanamide |
| SMILES | O=C(CCCC1CNNC1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H23N3O3/c20-16(3-1-2-13-9-18-19-10-13)17-7-6-12-4-5-14-15(8-12)22-11-21-14/h4-5,8,13,18-19H,1-3,6-7,9-11H2,(H,17,20) |
| InChIKey | DXSMEPRSSSZLJK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |