C21H24N6O3 — CID 22487861
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)amino]butanamide (PubChem CID 22487861) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)amino]butanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)amino]butanamide |
|---|---|
| PubChem CID | 22487861 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)amino]butanamide |
| SMILES | Cc1cc(NCCCC(=O)NCCc2ccc3c(c2)OCO3)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C21H24N6O3/c1-15-11-19(26-21(25-15)27-10-9-22-13-27)23-7-2-3-20(28)24-8-6-16-4-5-17-18(12-16)30-14-29-17/h4-5,9-13H,2-3,6-8,14H2,1H3,(H,24,28)(H,23,25,26) |
| InChIKey | NIMIKYKIUYRIGT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|