C21H29ClN6O2 — CID 68697142
4-[5-(1,3-benzodioxol-5-yl)-2-methylpentan-2-yl]-2-imidazol-1-yl-6-methylpyrimidine;hydrazine;hydrochloride (PubChem CID 68697142) has the molecular formula C21H29ClN6O2 and a molecular weight of 432.96 g/mol. Its IUPAC name is 4-[5-(1,3-benzodioxol-5-yl)-2-methylpentan-2-yl]-2-imidazol-1-yl-6-methylpyrimidine;hydrazine;hydrochloride.
| Compound Name | 4-[5-(1,3-benzodioxol-5-yl)-2-methylpentan-2-yl]-2-imidazol-1-yl-6-methylpyrimidine;hydrazine;hydrochloride |
|---|---|
| PubChem CID | 68697142 |
| Molecular Formula | C21H29ClN6O2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 4-[5-(1,3-benzodioxol-5-yl)-2-methylpentan-2-yl]-2-imidazol-1-yl-6-methylpyrimidine;hydrazine;hydrochloride |
| SMILES | Cc1cc(C(C)(C)CCCc2ccc3c(c2)OCO3)nc(-n2ccnc2)n1.Cl.NN |
| InChI | InChI=1S/C21H24N4O2.ClH.H4N2/c1-15-11-19(24-20(23-15)25-10-9-22-13-25)21(2,3)8-4-5-16-6-7-17-18(12-16)27-14-26-17;;1-2/h6-7,9-13H,4-5,8,14H2,1-3H3;1H;1-2H2 |
| InChIKey | ZRTZIXPJHFOIHP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|