C17H17N5O3S — CID 58654323
N-[3-(1,3-benzodioxol-5-yl)propyl]-2-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)acetamide (PubChem CID 58654323) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)propyl]-2-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)acetamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)propyl]-2-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 58654323 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)propyl]-2-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)acetamide |
| SMILES | O=C(Cc1nc(-n2ccnc2)ns1)NCCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17N5O3S/c23-15(9-16-20-17(21-26-16)22-7-6-18-10-22)19-5-1-2-12-3-4-13-14(8-12)25-11-24-13/h3-4,6-8,10H,1-2,5,9,11H2,(H,19,23) |
| InChIKey | UZNZDGVDCKJESD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|