C22H26N6O2S — CID 87975904
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)amino]-2-methylbutanethioamide (PubChem CID 87975904) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)amino]-2-methylbutanethioamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)amino]-2-methylbutanethioamide |
|---|---|
| PubChem CID | 87975904 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)amino]-2-methylbutanethioamide |
| SMILES | CCC(C)(Nc1cc(C)nc(-n2ccnc2)n1)C(=S)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H26N6O2S/c1-4-22(3,27-19-11-15(2)25-21(26-19)28-10-9-23-13-28)20(31)24-8-7-16-5-6-17-18(12-16)30-14-29-17/h5-6,9-13H,4,7-8,14H2,1-3H3,(H,24,31)(H,25,26,27) |
| InChIKey | ADEMIIOOZOOYDL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|