C17H17N3O6S — CID 18159216
4-[3-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide (PubChem CID 18159216) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is 4-[3-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | 4-[3-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18159216 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 4-[3-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCC(=O)NNC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H17N3O6S/c18-27(23,24)13-5-1-11(2-6-13)3-8-16(21)19-20-17(22)12-4-7-14-15(9-12)26-10-25-14/h1-2,4-7,9H,3,8,10H2,(H,19,21)(H,20,22)(H2,18,23,24) |
| InChIKey | LHMHVWJPIVTFIJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|