C16H17N3O5 — CID 8624242
N'-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 8624242) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is N'-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 8624242 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N'-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | Cc1noc(C)c1CCC(=O)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H17N3O5/c1-9-12(10(2)24-19-9)4-6-15(20)17-18-16(21)11-3-5-13-14(7-11)23-8-22-13/h3,5,7H,4,6,8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | PEJDXOACJLUHRE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|