C15H16FN3O3 — CID 8624261
N'-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]-2-fluorobenzohydrazide (PubChem CID 8624261) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is N'-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 8624261 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N'-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]-2-fluorobenzohydrazide |
| SMILES | Cc1noc(C)c1CCC(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H16FN3O3/c1-9-11(10(2)22-19-9)7-8-14(20)17-18-15(21)12-5-3-4-6-13(12)16/h3-6H,7-8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | NEILUQAMLJRRHW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|