C19H21N5O4 — CID 46634733
N'-[3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 46634733) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is N'-[3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 46634733 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N'-[3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | Cc1nn(CCC#N)c(C)c1CCC(=O)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H21N5O4/c1-12-15(13(2)24(23-12)9-3-8-20)5-7-18(25)21-22-19(26)14-4-6-16-17(10-14)28-11-27-16/h4,6,10H,3,5,7,9,11H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | PPZHTFDXHKZQNE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|