C19H25FN4O2 — CID 46664095
N'-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoyl]-4-fluorobenzohydrazide (PubChem CID 46664095) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is N'-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 46664095 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N'-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoyl]-4-fluorobenzohydrazide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CCC(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN4O2/c1-12(2)11-24-14(4)17(13(3)23-24)9-10-18(25)21-22-19(26)15-5-7-16(20)8-6-15/h5-8,12H,9-11H2,1-4H3,(H,21,25)(H,22,26) |
| InChIKey | LNTDJSYZEUSHPG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|