C28H32N6O2 — CID 46651465
N'-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoyl]-1,3-diphenylpyrazole-4-carbohydrazide (PubChem CID 46651465) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is N'-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoyl]-1,3-diphenylpyrazole-4-carbohydrazide.
| Compound Name | N'-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoyl]-1,3-diphenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46651465 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | N'-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoyl]-1,3-diphenylpyrazole-4-carbohydrazide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CCC(=O)NNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H32N6O2/c1-19(2)17-33-21(4)24(20(3)31-33)15-16-26(35)29-30-28(36)25-18-34(23-13-9-6-10-14-23)32-27(25)22-11-7-5-8-12-22/h5-14,18-19H,15-17H2,1-4H3,(H,29,35)(H,30,36) |
| InChIKey | JOCPUNMKNNGIBG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|