C21H29ClN4O2 — CID 39112466
2-chloro-N-[2-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoylamino]ethyl]benzamide (PubChem CID 39112466) has the molecular formula C21H29ClN4O2 and a molecular weight of 404.94 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoylamino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 39112466 |
| Molecular Formula | C21H29ClN4O2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-chloro-N-[2-[3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoylamino]ethyl]benzamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CCC(=O)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H29ClN4O2/c1-14(2)13-26-16(4)17(15(3)25-26)9-10-20(27)23-11-12-24-21(28)18-7-5-6-8-19(18)22/h5-8,14H,9-13H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | NIUOMTDQLGCKCO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|