C16H29N3O3S — CID 60550127
3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(3-methylsulfonylpropyl)propanamide (PubChem CID 60550127) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(3-methylsulfonylpropyl)propanamide.
| Compound Name | 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(3-methylsulfonylpropyl)propanamide |
|---|---|
| PubChem CID | 60550127 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(3-methylsulfonylpropyl)propanamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CCC(=O)NCCCS(C)(=O)=O |
| InChI | InChI=1S/C16H29N3O3S/c1-12(2)11-19-14(4)15(13(3)18-19)7-8-16(20)17-9-6-10-23(5,21)22/h12H,6-11H2,1-5H3,(H,17,20) |
| InChIKey | NFWVSNHJFOZSTN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|