C26H41N5O — CID 55620817
3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]propanamide (PubChem CID 55620817) has the molecular formula C26H41N5O and a molecular weight of 439.65 g/mol. Its IUPAC name is 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 55620817 |
| Molecular Formula | C26H41N5O |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.33 |
| IUPAC Name | 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]propanamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CCC(=O)NCCCN1CCN(C)CC1c1ccccc1 |
| InChI | InChI=1S/C26H41N5O/c1-20(2)18-31-22(4)24(21(3)28-31)12-13-26(32)27-14-9-15-30-17-16-29(5)19-25(30)23-10-7-6-8-11-23/h6-8,10-11,20,25H,9,12-19H2,1-5H3,(H,27,32) |
| InChIKey | IWSPTWGNYNTCFH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|