C16H15N3O7S — CID 47091237
4-[2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-2-oxoethoxy]benzenesulfonamide (PubChem CID 47091237) has the molecular formula C16H15N3O7S and a molecular weight of 393.38 g/mol. Its IUPAC name is 4-[2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-2-oxoethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-2-oxoethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 47091237 |
| Molecular Formula | C16H15N3O7S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-[2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-2-oxoethoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCC(=O)NNC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H15N3O7S/c17-27(22,23)12-4-2-11(3-5-12)24-8-15(20)18-19-16(21)10-1-6-13-14(7-10)26-9-25-13/h1-7H,8-9H2,(H,18,20)(H,19,21)(H2,17,22,23) |
| InChIKey | JAWSXKUPQBBVDE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|