C16H16N2O5S — CID 110767399
2-(1,3-benzodioxol-5-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 110767399) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 110767399 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H16N2O5S/c17-24(20,21)13-4-1-11(2-5-13)9-18-16(19)8-12-3-6-14-15(7-12)23-10-22-14/h1-7H,8-10H2,(H,18,19)(H2,17,20,21) |
| InChIKey | RURJZZNWBDRJPW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |