C17H19N3O5S — CID 4845099
2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 4845099) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 4845099 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(NCc1ccc2c(c1)OCO2)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H19N3O5S/c1-11(19-9-12-2-7-15-16(8-12)25-10-24-15)17(21)20-13-3-5-14(6-4-13)26(18,22)23/h2-8,11,19H,9-10H2,1H3,(H,20,21)(H2,18,22,23) |
| InChIKey | DUMCOOXRSHQOSB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |