C16H15BrN2O5S — CID 124553698
(2R)-N-(1,3-benzodioxol-5-yl)-2-[(4-bromophenyl)sulfonylamino]propanamide (PubChem CID 124553698) has the molecular formula C16H15BrN2O5S and a molecular weight of 427.28 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-yl)-2-[(4-bromophenyl)sulfonylamino]propanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-[(4-bromophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 124553698 |
| Molecular Formula | C16H15BrN2O5S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-[(4-bromophenyl)sulfonylamino]propanamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(Br)cc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15BrN2O5S/c1-10(19-25(21,22)13-5-2-11(17)3-6-13)16(20)18-12-4-7-14-15(8-12)24-9-23-14/h2-8,10,19H,9H2,1H3,(H,18,20)/t10-/m1/s1 |
| InChIKey | JHSMZDYLKQJULP-SNVBAGLBSA-N |
| XLogP | 2.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |