C17H18N2O3 — CID 17462314
N-[4-[(1,3-benzodioxol-5-ylmethylamino)methyl]phenyl]acetamide (PubChem CID 17462314) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-[4-[(1,3-benzodioxol-5-ylmethylamino)methyl]phenyl]acetamide.
| Compound Name | N-[4-[(1,3-benzodioxol-5-ylmethylamino)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 17462314 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[4-[(1,3-benzodioxol-5-ylmethylamino)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CNCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-12(20)19-15-5-2-13(3-6-15)9-18-10-14-4-7-16-17(8-14)22-11-21-16/h2-8,18H,9-11H2,1H3,(H,19,20) |
| InChIKey | MXFRMKYRXNPNTN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |