C20H25N3O3 — CID 108998771
2-(1,3-benzodioxol-5-ylmethylamino)-N-[4-(diethylamino)phenyl]acetamide (PubChem CID 108998771) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-N-[4-(diethylamino)phenyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-[4-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 108998771 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-[4-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CNCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-3-23(4-2)17-8-6-16(7-9-17)22-20(24)13-21-12-15-5-10-18-19(11-15)26-14-25-18/h5-11,21H,3-4,12-14H2,1-2H3,(H,22,24) |
| InChIKey | HWYUOINFQVUMDE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|