C21H25N3O4 — CID 108956695
N-(1,3-benzodioxol-5-yl)-N'-[4-(diethylamino)-2-methylphenyl]propanediamide (PubChem CID 108956695) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-[4-(diethylamino)-2-methylphenyl]propanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-[4-(diethylamino)-2-methylphenyl]propanediamide |
|---|---|
| PubChem CID | 108956695 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-[4-(diethylamino)-2-methylphenyl]propanediamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CC(=O)Nc2ccc3c(c2)OCO3)c(C)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-4-24(5-2)16-7-8-17(14(3)10-16)23-21(26)12-20(25)22-15-6-9-18-19(11-15)28-13-27-18/h6-11H,4-5,12-13H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | VAKWEXGKJNLSQQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|