C16H13IN2O4 — CID 108516432
N-(1,3-benzodioxol-5-yl)-N'-(4-iodo-2-methylphenyl)oxamide (PubChem CID 108516432) has the molecular formula C16H13IN2O4 and a molecular weight of 424.19 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(4-iodo-2-methylphenyl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(4-iodo-2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108516432 |
| Molecular Formula | C16H13IN2O4 |
| Molecular Weight | 424.19 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(4-iodo-2-methylphenyl)oxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13IN2O4/c1-9-6-10(17)2-4-12(9)19-16(21)15(20)18-11-3-5-13-14(7-11)23-8-22-13/h2-7H,8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | DUSLOGREFNHOMX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|