C20H22N2O4 — CID 108967844
N-(1,3-benzodioxol-5-yl)-N'-(2,4-dimethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108967844) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(2,4-dimethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(2,4-dimethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108967844 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(2,4-dimethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C(=O)Nc2ccc3c(c2)OCO3)c(C)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-12-5-7-15(13(2)9-12)22-19(24)20(3,4)18(23)21-14-6-8-16-17(10-14)26-11-25-16/h5-10H,11H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | JZGNSNSRPZWHIF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|