C20H20N2O5 — CID 108969732
N-(3-acetylphenyl)-N'-(1,3-benzodioxol-5-yl)-2,2-dimethylpropanediamide (PubChem CID 108969732) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N'-(1,3-benzodioxol-5-yl)-2,2-dimethylpropanediamide.
| Compound Name | N-(3-acetylphenyl)-N'-(1,3-benzodioxol-5-yl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108969732 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-(3-acetylphenyl)-N'-(1,3-benzodioxol-5-yl)-2,2-dimethylpropanediamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(C)(C)C(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-12(23)13-5-4-6-14(9-13)21-18(24)20(2,3)19(25)22-15-7-8-16-17(10-15)27-11-26-16/h4-10H,11H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | QSNVNHFZTPTJDW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|