C21H22N2O4 — CID 108969722
N-(3-acetylphenyl)-N'-(4-acetylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108969722) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N'-(4-acetylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(3-acetylphenyl)-N'-(4-acetylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108969722 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-(3-acetylphenyl)-N'-(4-acetylphenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)(C)C(=O)Nc2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C21H22N2O4/c1-13(24)15-8-10-17(11-9-15)22-19(26)21(3,4)20(27)23-18-7-5-6-16(12-18)14(2)25/h5-12H,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | AAOOZWZXTIGYKZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|