C20H22N2O3 — CID 108967277
N-(3-acetylphenyl)-2,2-dimethyl-N'-(2-methylphenyl)propanediamide (PubChem CID 108967277) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2,2-dimethyl-N'-(2-methylphenyl)propanediamide.
| Compound Name | N-(3-acetylphenyl)-2,2-dimethyl-N'-(2-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 108967277 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-(3-acetylphenyl)-2,2-dimethyl-N'-(2-methylphenyl)propanediamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(C)(C)C(=O)Nc2ccccc2C)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-13-8-5-6-11-17(13)22-19(25)20(3,4)18(24)21-16-10-7-9-15(12-16)14(2)23/h5-12H,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | VSXCNPHVGVUNHU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|