C21H24N2O3 — CID 108967830
N-(4-acetylphenyl)-N'-(2,4-dimethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108967830) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(2,4-dimethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(4-acetylphenyl)-N'-(2,4-dimethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108967830 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(2,4-dimethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)(C)C(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-13-6-11-18(14(2)12-13)23-20(26)21(4,5)19(25)22-17-9-7-16(8-10-17)15(3)24/h6-12H,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | MIFJCOWYINHKEL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|