C20H22N2O5 — CID 108969318
methyl 3-[[3-(2-methoxyanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate (PubChem CID 108969318) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 3-[[3-(2-methoxyanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-(2-methoxyanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108969318 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl 3-[[3-(2-methoxyanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C(C)(C)C(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-20(2,19(25)22-15-10-5-6-11-16(15)26-3)18(24)21-14-9-7-8-13(12-14)17(23)27-4/h5-12H,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | SIEUCCMZQJVXSX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|