C21H24N2O5 — CID 108969510
methyl 3-[[3-(4-ethoxyanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate (PubChem CID 108969510) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 3-[[3-(4-ethoxyanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-(4-ethoxyanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108969510 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl 3-[[3-(4-ethoxyanilino)-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
| SMILES | CCOc1ccc(NC(=O)C(C)(C)C(=O)Nc2cccc(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-5-28-17-11-9-15(10-12-17)22-19(25)21(2,3)20(26)23-16-8-6-7-14(13-16)18(24)27-4/h6-13H,5H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | NGUCDRIHOQTRKH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|