C18H26N2O4 — CID 108966429
methyl 3-[[2,2-dimethyl-3-oxo-3-(pentylamino)propanoyl]amino]benzoate (PubChem CID 108966429) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 3-[[2,2-dimethyl-3-oxo-3-(pentylamino)propanoyl]amino]benzoate.
| Compound Name | methyl 3-[[2,2-dimethyl-3-oxo-3-(pentylamino)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108966429 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | methyl 3-[[2,2-dimethyl-3-oxo-3-(pentylamino)propanoyl]amino]benzoate |
| SMILES | CCCCCNC(=O)C(C)(C)C(=O)Nc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H26N2O4/c1-5-6-7-11-19-16(22)18(2,3)17(23)20-14-10-8-9-13(12-14)15(21)24-4/h8-10,12H,5-7,11H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | AVNQTRUWBAHHKO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|