C18H22N4O3 — CID 109263813
methyl 3-[[2-(pentylamino)pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 109263813) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is methyl 3-[[2-(pentylamino)pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(pentylamino)pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109263813 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | methyl 3-[[2-(pentylamino)pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | CCCCCNc1ncc(C(=O)Nc2cccc(C(=O)OC)c2)cn1 |
| InChI | InChI=1S/C18H22N4O3/c1-3-4-5-9-19-18-20-11-14(12-21-18)16(23)22-15-8-6-7-13(10-15)17(24)25-2/h6-8,10-12H,3-5,9H2,1-2H3,(H,22,23)(H,19,20,21) |
| InChIKey | ZSASUSQQHBWYOY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|