C18H20N4O4 — CID 109252629
methyl 3-[[2-(oxolan-2-ylmethylamino)pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 109252629) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 3-[[2-(oxolan-2-ylmethylamino)pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(oxolan-2-ylmethylamino)pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109252629 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | methyl 3-[[2-(oxolan-2-ylmethylamino)pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cnc(NCC3CCCO3)nc2)c1 |
| InChI | InChI=1S/C18H20N4O4/c1-25-17(24)12-4-2-5-14(8-12)22-16(23)13-9-19-18(20-10-13)21-11-15-6-3-7-26-15/h2,4-5,8-10,15H,3,6-7,11H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | PIKLGNXEKJPRHT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |