C14H22N4O3 — CID 109251671
N-(3-methoxypropyl)-2-(oxolan-2-ylmethylamino)pyrimidine-5-carboxamide (PubChem CID 109251671) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(oxolan-2-ylmethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2-(oxolan-2-ylmethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109251671 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-(3-methoxypropyl)-2-(oxolan-2-ylmethylamino)pyrimidine-5-carboxamide |
| SMILES | COCCCNC(=O)c1cnc(NCC2CCCO2)nc1 |
| InChI | InChI=1S/C14H22N4O3/c1-20-6-3-5-15-13(19)11-8-16-14(17-9-11)18-10-12-4-2-7-21-12/h8-9,12H,2-7,10H2,1H3,(H,15,19)(H,16,17,18) |
| InChIKey | LRNVXGFNPAOBEV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|