C20H21NO5 — CID 25496492
methyl 3-[[3-[[(2R)-oxolan-2-yl]methoxy]benzoyl]amino]benzoate (PubChem CID 25496492) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl 3-[[3-[[(2R)-oxolan-2-yl]methoxy]benzoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-[[(2R)-oxolan-2-yl]methoxy]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 25496492 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | methyl 3-[[3-[[(2R)-oxolan-2-yl]methoxy]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cccc(OC[C@H]3CCCO3)c2)c1 |
| InChI | InChI=1S/C20H21NO5/c1-24-20(23)15-6-2-7-16(11-15)21-19(22)14-5-3-8-17(12-14)26-13-18-9-4-10-25-18/h2-3,5-8,11-12,18H,4,9-10,13H2,1H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | NWNDHCDHFDNSOS-GOSISDBHSA-N |
| XLogP | 3.28 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |