C22H25NO5 — CID 24633199
propan-2-yl 4-[[3-(oxolan-2-ylmethoxy)benzoyl]amino]benzoate (PubChem CID 24633199) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is propan-2-yl 4-[[3-(oxolan-2-ylmethoxy)benzoyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[3-(oxolan-2-ylmethoxy)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 24633199 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | propan-2-yl 4-[[3-(oxolan-2-ylmethoxy)benzoyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)c2cccc(OCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C22H25NO5/c1-15(2)28-22(25)16-8-10-18(11-9-16)23-21(24)17-5-3-6-19(13-17)27-14-20-7-4-12-26-20/h3,5-6,8-11,13,15,20H,4,7,12,14H2,1-2H3,(H,23,24) |
| InChIKey | BWXUWJONHCBVGJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |