C16H20N4O2 — CID 109248366
2-(butylamino)-N-(4-methoxyphenyl)pyrimidine-5-carboxamide (PubChem CID 109248366) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(butylamino)-N-(4-methoxyphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-N-(4-methoxyphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109248366 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-(butylamino)-N-(4-methoxyphenyl)pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)Nc2ccc(OC)cc2)cn1 |
| InChI | InChI=1S/C16H20N4O2/c1-3-4-9-17-16-18-10-12(11-19-16)15(21)20-13-5-7-14(22-2)8-6-13/h5-8,10-11H,3-4,9H2,1-2H3,(H,20,21)(H,17,18,19) |
| InChIKey | QIUXCDPPFYUTFT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|